About 7-(2-cyclohexylethyl)-3-cyclopenta-1,4-dien-1-yl-3aH-indole;propane
7-(2-cyclohexylethyl)-3-cyclopenta-1,4-dien-1-yl-3aH-indole;propane (PubChem CID 143755900) has the molecular formula C24H33N
and a molecular weight of 335.54 g/mol. Its IUPAC name is 7-(2-cyclohexylethyl)-3-cyclopenta-1,4-dien-1-yl-3aH-indole;propane.
Molecular Properties
| Compound Name | 7-(2-cyclohexylethyl)-3-cyclopenta-1,4-dien-1-yl-3aH-indole;propane |
| PubChem CID | 143755900 |
| Molecular Formula | C24H33N |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 7-(2-cyclohexylethyl)-3-cyclopenta-1,4-dien-1-yl-3aH-indole;propane |
| SMILES | C1=CC2C(C3=CCC=C3)=CN=C2C(CCC2CCCCC2)=C1.CCC |
| InChI | InChI=1S/C21H25N.C3H8/c1-2-7-16(8-3-1)13-14-18-11-6-12-19-20(15-22-21(18)19)17-9-4-5-10-17;1-3-2/h4,6,9-12,15-16,19H,1-3,5,7-8,13-14H2;3H2,1-2H3 |
| InChIKey | CDTCFRWIJPBBLW-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-(2-cyclohexylethyl)-3-cyclopenta-1,4-dien-1-yl-3aH-indole;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-cyclohexylethyl)-3-cyclopenta-1,4-dien-1-yl-3aH-indole;propane?
The IUPAC name of 7-(2-cyclohexylethyl)-3-cyclopenta-1,4-dien-1-yl-3aH-indole;propane (CID 143755900) is 7-(2-cyclohexylethyl)-3-cyclopenta-1,4-dien-1-yl-3aH-indole;propane.
What is the SMILES notation for 7-(2-cyclohexylethyl)-3-cyclopenta-1,4-dien-1-yl-3aH-indole;propane?
The canonical SMILES for 7-(2-cyclohexylethyl)-3-cyclopenta-1,4-dien-1-yl-3aH-indole;propane is C1=CC2C(C3=CCC=C3)=CN=C2C(CCC2CCCCC2)=C1.CCC.
What is the InChIKey of 7-(2-cyclohexylethyl)-3-cyclopenta-1,4-dien-1-yl-3aH-indole;propane?
The InChIKey is CDTCFRWIJPBBLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N.C3H8/c1-2-7-16(8-3-1)13-14-18-11-6-12-19-20(15-22-21(18)19)17-9-4-5-10-17;1-3-2/h4,6,9-12,15-16,19H,1-3,5,7-8,13-14H2;3H2,1-2H3.
What are the key properties of 7-(2-cyclohexylethyl)-3-cyclopenta-1,4-dien-1-yl-3aH-indole;propane?
7-(2-cyclohexylethyl)-3-cyclopenta-1,4-dien-1-yl-3aH-indole;propane has a molecular weight of 335.54 g/mol, XLogP of 7.10, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-cyclohexylethyl)-3-cyclopenta-1,4-dien-1-yl-3aH-indole;propane is sourced from PubChem (CID 143755900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).