C22H32N2 — CID 143755931
7-(cyclohexylmethyl)-3-[(3E)-penta-1,3-dien-3-yl]-3aH-pyrrolo[2,3-c]pyridine;propane (PubChem CID 143755931) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 7-(cyclohexylmethyl)-3-[(3E)-penta-1,3-dien-3-yl]-3aH-pyrrolo[2,3-c]pyridine;propane.
| Compound Name | 7-(cyclohexylmethyl)-3-[(3E)-penta-1,3-dien-3-yl]-3aH-pyrrolo[2,3-c]pyridine;propane |
|---|---|
| PubChem CID | 143755931 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 7-(cyclohexylmethyl)-3-[(3E)-penta-1,3-dien-3-yl]-3aH-pyrrolo[2,3-c]pyridine;propane |
| SMILES | C=C/C(=C\C)C1=CN=C2C(CC3CCCCC3)=NC=CC12.CCC |
| InChI | InChI=1S/C19H24N2.C3H8/c1-3-15(4-2)17-13-21-19-16(17)10-11-20-18(19)12-14-8-6-5-7-9-14;1-3-2/h3-4,10-11,13-14,16H,1,5-9,12H2,2H3;3H2,1-2H3/b15-4+; |
| InChIKey | JYDOJQODOVJWBS-HDNKIUSMSA-N |
| XLogP | 6.43 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|