About ethane;N-(2-ethoxyethyl)-3-methylimidazo[1,2-a]pyrazin-8-amine
ethane;N-(2-ethoxyethyl)-3-methylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 143756054) has the molecular formula C13H22N4O
and a molecular weight of 250.35 g/mol. Its IUPAC name is ethane;N-(2-ethoxyethyl)-3-methylimidazo[1,2-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | ethane;N-(2-ethoxyethyl)-3-methylimidazo[1,2-a]pyrazin-8-amine |
| PubChem CID | 143756054 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | ethane;N-(2-ethoxyethyl)-3-methylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | CC.CCOCCNc1nccn2c(C)cnc12 |
| InChI | InChI=1S/C11H16N4O.C2H6/c1-3-16-7-5-13-10-11-14-8-9(2)15(11)6-4-12-10;1-2/h4,6,8H,3,5,7H2,1-2H3,(H,12,13);1-2H3 |
| InChIKey | MKGGBFJGTGNSSS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-(2-ethoxyethyl)-3-methylimidazo[1,2-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(2-ethoxyethyl)-3-methylimidazo[1,2-a]pyrazin-8-amine?
The IUPAC name of ethane;N-(2-ethoxyethyl)-3-methylimidazo[1,2-a]pyrazin-8-amine (CID 143756054) is ethane;N-(2-ethoxyethyl)-3-methylimidazo[1,2-a]pyrazin-8-amine.
What is the SMILES notation for ethane;N-(2-ethoxyethyl)-3-methylimidazo[1,2-a]pyrazin-8-amine?
The canonical SMILES for ethane;N-(2-ethoxyethyl)-3-methylimidazo[1,2-a]pyrazin-8-amine is CC.CCOCCNc1nccn2c(C)cnc12.
What is the InChIKey of ethane;N-(2-ethoxyethyl)-3-methylimidazo[1,2-a]pyrazin-8-amine?
The InChIKey is MKGGBFJGTGNSSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O.C2H6/c1-3-16-7-5-13-10-11-14-8-9(2)15(11)6-4-12-10;1-2/h4,6,8H,3,5,7H2,1-2H3,(H,12,13);1-2H3.
What are the key properties of ethane;N-(2-ethoxyethyl)-3-methylimidazo[1,2-a]pyrazin-8-amine?
ethane;N-(2-ethoxyethyl)-3-methylimidazo[1,2-a]pyrazin-8-amine has a molecular weight of 250.35 g/mol, XLogP of 2.51, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(2-ethoxyethyl)-3-methylimidazo[1,2-a]pyrazin-8-amine is sourced from PubChem (CID 143756054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).