C20H27N5S — CID 143756059
N-[(1Z)-3-cyclopropyl-1-sulfanylbuta-1,3-dienyl]-2-[(E)-2-(1-methylpyrazol-4-yl)prop-1-enyl]imino-N'-[(Z)-prop-1-enyl]propanimidamide (PubChem CID 143756059) has the molecular formula C20H27N5S and a molecular weight of 369.54 g/mol. Its IUPAC name is N-[(1Z)-3-cyclopropyl-1-sulfanylbuta-1,3-dienyl]-2-[(E)-2-(1-methylpyrazol-4-yl)prop-1-enyl]imino-N'-[(Z)-prop-1-enyl]propanimidamide.
| Compound Name | N-[(1Z)-3-cyclopropyl-1-sulfanylbuta-1,3-dienyl]-2-[(E)-2-(1-methylpyrazol-4-yl)prop-1-enyl]imino-N'-[(Z)-prop-1-enyl]propanimidamide |
|---|---|
| PubChem CID | 143756059 |
| Molecular Formula | C20H27N5S |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | N-[(1Z)-3-cyclopropyl-1-sulfanylbuta-1,3-dienyl]-2-[(E)-2-(1-methylpyrazol-4-yl)prop-1-enyl]imino-N'-[(Z)-prop-1-enyl]propanimidamide |
| SMILES | C=C(/C=C(\S)NC(=N/C=C\C)/C(C)=N/C=C(\C)c1cnn(C)c1)C1CC1 |
| InChI | InChI=1S/C20H27N5S/c1-6-9-21-20(24-19(26)10-14(2)17-7-8-17)16(4)22-11-15(3)18-12-23-25(5)13-18/h6,9-13,17,26H,2,7-8H2,1,3-5H3,(H,21,24)/b9-6-,15-11+,19-10-,22-16+ |
| InChIKey | MQRIZSLIKGIDHP-SZVOYGQHSA-N |
| XLogP | 4.50 |
| TPSA | 54.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|