C28H31F2N9OS — CID 143756300
N-(2,3-difluorophenyl)-2-[4-[6-methyl-8-[[3-[[(3R)-3-methylpiperidin-1-yl]methyl]-1,2-thiazol-5-yl]amino]imidazo[1,2-a]pyrazin-3-yl]-1,5-dihydropyrazol-2-yl]acetamide (PubChem CID 143756300) has the molecular formula C28H31F2N9OS and a molecular weight of 579.68 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-2-[4-[6-methyl-8-[[3-[[(3R)-3-methylpiperidin-1-yl]methyl]-1,2-thiazol-5-yl]amino]imidazo[1,2-a]pyrazin-3-yl]-1,5-dihydropyrazol-2-yl]acetamide.
| Compound Name | N-(2,3-difluorophenyl)-2-[4-[6-methyl-8-[[3-[[(3R)-3-methylpiperidin-1-yl]methyl]-1,2-thiazol-5-yl]amino]imidazo[1,2-a]pyrazin-3-yl]-1,5-dihydropyrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 143756300 |
| Molecular Formula | C28H31F2N9OS |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | N-(2,3-difluorophenyl)-2-[4-[6-methyl-8-[[3-[[(3R)-3-methylpiperidin-1-yl]methyl]-1,2-thiazol-5-yl]amino]imidazo[1,2-a]pyrazin-3-yl]-1,5-dihydropyrazol-2-yl]acetamide |
| SMILES | Cc1cn2c(C3=CN(CC(=O)Nc4cccc(F)c4F)NC3)cnc2c(Nc2cc(CN3CCC[C@@H](C)C3)ns2)n1 |
| InChI | InChI=1S/C28H31F2N9OS/c1-17-5-4-8-37(12-17)15-20-9-25(41-36-20)35-27-28-31-11-23(39(28)13-18(2)33-27)19-10-32-38(14-19)16-24(40)34-22-7-3-6-21(29)26(22)30/h3,6-7,9,11,13-14,17,32H,4-5,8,10,12,15-16H2,1-2H3,(H,33,35)(H,34,40)/t17-/m1/s1 |
| InChIKey | BAHSSMAEJUDMBC-QGZVFWFLSA-N |
| XLogP | 4.55 |
| TPSA | 102.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |