About 3-(2,3-dihydro-1H-pyrazol-4-yl)-8-methylimidazo[1,2-a]pyrazine
3-(2,3-dihydro-1H-pyrazol-4-yl)-8-methylimidazo[1,2-a]pyrazine (PubChem CID 143756408) has the molecular formula C10H11N5
and a molecular weight of 201.23 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-pyrazol-4-yl)-8-methylimidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 3-(2,3-dihydro-1H-pyrazol-4-yl)-8-methylimidazo[1,2-a]pyrazine |
| PubChem CID | 143756408 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 3-(2,3-dihydro-1H-pyrazol-4-yl)-8-methylimidazo[1,2-a]pyrazine |
| SMILES | Cc1nccn2c(C3=CNNC3)cnc12 |
| InChI | InChI=1S/C10H11N5/c1-7-10-12-6-9(8-4-13-14-5-8)15(10)3-2-11-7/h2-4,6,13-14H,5H2,1H3 |
| InChIKey | UESDNUJAXQSXSA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2,3-dihydro-1H-pyrazol-4-yl)-8-methylimidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydro-1H-pyrazol-4-yl)-8-methylimidazo[1,2-a]pyrazine?
The IUPAC name of 3-(2,3-dihydro-1H-pyrazol-4-yl)-8-methylimidazo[1,2-a]pyrazine (CID 143756408) is 3-(2,3-dihydro-1H-pyrazol-4-yl)-8-methylimidazo[1,2-a]pyrazine.
What is the SMILES notation for 3-(2,3-dihydro-1H-pyrazol-4-yl)-8-methylimidazo[1,2-a]pyrazine?
The canonical SMILES for 3-(2,3-dihydro-1H-pyrazol-4-yl)-8-methylimidazo[1,2-a]pyrazine is Cc1nccn2c(C3=CNNC3)cnc12.
What is the InChIKey of 3-(2,3-dihydro-1H-pyrazol-4-yl)-8-methylimidazo[1,2-a]pyrazine?
The InChIKey is UESDNUJAXQSXSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5/c1-7-10-12-6-9(8-4-13-14-5-8)15(10)3-2-11-7/h2-4,6,13-14H,5H2,1H3.
What are the key properties of 3-(2,3-dihydro-1H-pyrazol-4-yl)-8-methylimidazo[1,2-a]pyrazine?
3-(2,3-dihydro-1H-pyrazol-4-yl)-8-methylimidazo[1,2-a]pyrazine has a molecular weight of 201.23 g/mol, XLogP of 0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydro-1H-pyrazol-4-yl)-8-methylimidazo[1,2-a]pyrazine is sourced from PubChem (CID 143756408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).