C20H22O4 — CID 14375763
3-methyl-4-(2-methyl-3,4-dioxo-5-propan-2-ylcyclohexa-1,5-dien-1-yl)-6-propan-2-ylcyclohexa-3,5-diene-1,2-dione (PubChem CID 14375763) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is 3-methyl-4-(2-methyl-3,4-dioxo-5-propan-2-ylcyclohexa-1,5-dien-1-yl)-6-propan-2-ylcyclohexa-3,5-diene-1,2-dione.
| Compound Name | 3-methyl-4-(2-methyl-3,4-dioxo-5-propan-2-ylcyclohexa-1,5-dien-1-yl)-6-propan-2-ylcyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 14375763 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 3-methyl-4-(2-methyl-3,4-dioxo-5-propan-2-ylcyclohexa-1,5-dien-1-yl)-6-propan-2-ylcyclohexa-3,5-diene-1,2-dione |
| SMILES | CC1=C(C2=C(C)C(=O)C(=O)C(C(C)C)=C2)C=C(C(C)C)C(=O)C1=O |
| InChI | InChI=1S/C20H22O4/c1-9(2)13-7-15(11(5)17(21)19(13)23)16-8-14(10(3)4)20(24)18(22)12(16)6/h7-10H,1-6H3 |
| InChIKey | OTCZINUTVRBSEL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|