C10H15N7S — CID 143757782
6-(1-methylimidazol-2-yl)sulfanyl-1,3,5-triazine-2,4-diamine;prop-1-ene (PubChem CID 143757782) has the molecular formula C10H15N7S and a molecular weight of 265.35 g/mol. Its IUPAC name is 6-(1-methylimidazol-2-yl)sulfanyl-1,3,5-triazine-2,4-diamine;prop-1-ene.
| Compound Name | 6-(1-methylimidazol-2-yl)sulfanyl-1,3,5-triazine-2,4-diamine;prop-1-ene |
|---|---|
| PubChem CID | 143757782 |
| Molecular Formula | C10H15N7S |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 6-(1-methylimidazol-2-yl)sulfanyl-1,3,5-triazine-2,4-diamine;prop-1-ene |
| SMILES | C=CC.Cn1ccnc1Sc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C7H9N7S.C3H6/c1-14-3-2-10-7(14)15-6-12-4(8)11-5(9)13-6;1-3-2/h2-3H,1H3,(H4,8,9,11,12,13);3H,1H2,2H3 |
| InChIKey | TUTCPKVKDWINJP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 108.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|