C11H15N3O2 — CID 143757787
ethane;3-(1-methylpyrrol-2-yl)-1H-pyrazole-5-carboxylic acid (PubChem CID 143757787) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is ethane;3-(1-methylpyrrol-2-yl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | ethane;3-(1-methylpyrrol-2-yl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 143757787 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | ethane;3-(1-methylpyrrol-2-yl)-1H-pyrazole-5-carboxylic acid |
| SMILES | CC.Cn1cccc1-c1cc(C(=O)O)[nH]n1 |
| InChI | InChI=1S/C9H9N3O2.C2H6/c1-12-4-2-3-8(12)6-5-7(9(13)14)11-10-6;1-2/h2-5H,1H3,(H,10,11)(H,13,14);1-2H3 |
| InChIKey | QYQVRAYXZNADNY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |