About 1,4-dimethylpiperazine;bis(1,4-dimethylpiperidine)
1,4-dimethylpiperazine;bis(1,4-dimethylpiperidine) (PubChem CID 143758310) has the molecular formula C20H44N4
and a molecular weight of 340.60 g/mol. Its IUPAC name is 1,4-dimethylpiperazine;bis(1,4-dimethylpiperidine).
Molecular Properties
| Compound Name | 1,4-dimethylpiperazine;bis(1,4-dimethylpiperidine) |
| PubChem CID | 143758310 |
| Molecular Formula | C20H44N4 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.36 |
| IUPAC Name | 1,4-dimethylpiperazine;bis(1,4-dimethylpiperidine) |
| SMILES | CC1CCN(C)CC1.CC1CCN(C)CC1.CN1CCN(C)CC1 |
| InChI | InChI=1S/2C7H15N.C6H14N2/c3*1-7-3-5-8(2)6-4-7/h2*7H,3-6H2,1-2H3;3-6H2,1-2H3 |
| InChIKey | VEQPTIVKSWTWDX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,4-dimethylpiperazine;bis(1,4-dimethylpiperidine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylpiperazine;bis(1,4-dimethylpiperidine)?
The IUPAC name of 1,4-dimethylpiperazine;bis(1,4-dimethylpiperidine) (CID 143758310) is 1,4-dimethylpiperazine;bis(1,4-dimethylpiperidine).
What is the SMILES notation for 1,4-dimethylpiperazine;bis(1,4-dimethylpiperidine)?
The canonical SMILES for 1,4-dimethylpiperazine;bis(1,4-dimethylpiperidine) is CC1CCN(C)CC1.CC1CCN(C)CC1.CN1CCN(C)CC1.
What is the InChIKey of 1,4-dimethylpiperazine;bis(1,4-dimethylpiperidine)?
The InChIKey is VEQPTIVKSWTWDX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H15N.C6H14N2/c3*1-7-3-5-8(2)6-4-7/h2*7H,3-6H2,1-2H3;3-6H2,1-2H3.
What are the key properties of 1,4-dimethylpiperazine;bis(1,4-dimethylpiperidine)?
1,4-dimethylpiperazine;bis(1,4-dimethylpiperidine) has a molecular weight of 340.60 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylpiperazine;bis(1,4-dimethylpiperidine) is sourced from PubChem (CID 143758310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).