About 1,3-dimethoxy-5-methyl-1,3,5-triazinane
1,3-dimethoxy-5-methyl-1,3,5-triazinane (PubChem CID 143758568) has the molecular formula C6H15N3O2
and a molecular weight of 161.21 g/mol. Its IUPAC name is 1,3-dimethoxy-5-methyl-1,3,5-triazinane.
Molecular Properties
| Compound Name | 1,3-dimethoxy-5-methyl-1,3,5-triazinane |
| PubChem CID | 143758568 |
| Molecular Formula | C6H15N3O2 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 1,3-dimethoxy-5-methyl-1,3,5-triazinane |
| SMILES | CON1CN(C)CN(OC)C1 |
| InChI | InChI=1S/C6H15N3O2/c1-7-4-8(10-2)6-9(5-7)11-3/h4-6H2,1-3H3 |
| InChIKey | CDUKPWOIKIPHNY-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-dimethoxy-5-methyl-1,3,5-triazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethoxy-5-methyl-1,3,5-triazinane?
The IUPAC name of 1,3-dimethoxy-5-methyl-1,3,5-triazinane (CID 143758568) is 1,3-dimethoxy-5-methyl-1,3,5-triazinane.
What is the SMILES notation for 1,3-dimethoxy-5-methyl-1,3,5-triazinane?
The canonical SMILES for 1,3-dimethoxy-5-methyl-1,3,5-triazinane is CON1CN(C)CN(OC)C1.
What is the InChIKey of 1,3-dimethoxy-5-methyl-1,3,5-triazinane?
The InChIKey is CDUKPWOIKIPHNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3O2/c1-7-4-8(10-2)6-9(5-7)11-3/h4-6H2,1-3H3.
What are the key properties of 1,3-dimethoxy-5-methyl-1,3,5-triazinane?
1,3-dimethoxy-5-methyl-1,3,5-triazinane has a molecular weight of 161.21 g/mol, XLogP of -0.47, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethoxy-5-methyl-1,3,5-triazinane is sourced from PubChem (CID 143758568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).