C15H29N — CID 143758684
(4E)-2,4,5,6,6-pentamethylhepta-1,4-dien-3-imine;propane (PubChem CID 143758684) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is (4E)-2,4,5,6,6-pentamethylhepta-1,4-dien-3-imine;propane.
| Compound Name | (4E)-2,4,5,6,6-pentamethylhepta-1,4-dien-3-imine;propane |
|---|---|
| PubChem CID | 143758684 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | (4E)-2,4,5,6,6-pentamethylhepta-1,4-dien-3-imine;propane |
| SMILES | CCC.[H]/N=C(C(=C)C)/C(C)=C(\C)C(C)(C)C |
| InChI | InChI=1S/C12H21N.C3H8/c1-8(2)11(13)9(3)10(4)12(5,6)7;1-3-2/h13H,1H2,2-7H3;3H2,1-2H3/b10-9+,13-11+; |
| InChIKey | BGDCVQAXQHTJMU-XVGILUMNSA-N |
| XLogP | 5.38 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|