C24H21FO3 — CID 143758775
(2R,6S)-8-(4-fluorophenyl)-5-hydroxy-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 143758775) has the molecular formula C24H21FO3 and a molecular weight of 376.43 g/mol. Its IUPAC name is (2R,6S)-8-(4-fluorophenyl)-5-hydroxy-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (2R,6S)-8-(4-fluorophenyl)-5-hydroxy-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 143758775 |
| Molecular Formula | C24H21FO3 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (2R,6S)-8-(4-fluorophenyl)-5-hydroxy-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | Cc1cc(C)c(C2=C(O)[C@@H]3C4OC(C=C4c4ccc(F)cc4)[C@@H]3C2=O)c(C)c1 |
| InChI | InChI=1S/C24H21FO3/c1-11-8-12(2)18(13(3)9-11)20-22(26)19-17-10-16(14-4-6-15(25)7-5-14)24(28-17)21(19)23(20)27/h4-10,17,19,21,24,27H,1-3H3/t17?,19-,21+,24?/m0/s1 |
| InChIKey | FUCUGXYMPVGLEL-MCBDARDXSA-N |
| XLogP | 4.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |