C23H32N6O2 — CID 143759072
6-[cyclohexyl(2-methoxyethyl)amino]-N-(1H-indazol-5-yl)pyrimidine-4-carboxamide;ethane (PubChem CID 143759072) has the molecular formula C23H32N6O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 6-[cyclohexyl(2-methoxyethyl)amino]-N-(1H-indazol-5-yl)pyrimidine-4-carboxamide;ethane.
| Compound Name | 6-[cyclohexyl(2-methoxyethyl)amino]-N-(1H-indazol-5-yl)pyrimidine-4-carboxamide;ethane |
|---|---|
| PubChem CID | 143759072 |
| Molecular Formula | C23H32N6O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 6-[cyclohexyl(2-methoxyethyl)amino]-N-(1H-indazol-5-yl)pyrimidine-4-carboxamide;ethane |
| SMILES | CC.COCCN(c1cc(C(=O)Nc2ccc3[nH]ncc3c2)ncn1)C1CCCCC1 |
| InChI | InChI=1S/C21H26N6O2.C2H6/c1-29-10-9-27(17-5-3-2-4-6-17)20-12-19(22-14-23-20)21(28)25-16-7-8-18-15(11-16)13-24-26-18;1-2/h7-8,11-14,17H,2-6,9-10H2,1H3,(H,24,26)(H,25,28);1-2H3 |
| InChIKey | BNNGDWQFZPTGDY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |