C25H35N5O2S — CID 143759110
6-[cyclohexyl(cyclopropylmethyl)amino]-N-[4-(2-methoxyethylamino)sulfanyl-2-methylphenyl]pyrimidine-4-carboxamide (PubChem CID 143759110) has the molecular formula C25H35N5O2S and a molecular weight of 469.66 g/mol. Its IUPAC name is 6-[cyclohexyl(cyclopropylmethyl)amino]-N-[4-(2-methoxyethylamino)sulfanyl-2-methylphenyl]pyrimidine-4-carboxamide.
| Compound Name | 6-[cyclohexyl(cyclopropylmethyl)amino]-N-[4-(2-methoxyethylamino)sulfanyl-2-methylphenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 143759110 |
| Molecular Formula | C25H35N5O2S |
| Molecular Weight | 469.66 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 6-[cyclohexyl(cyclopropylmethyl)amino]-N-[4-(2-methoxyethylamino)sulfanyl-2-methylphenyl]pyrimidine-4-carboxamide |
| SMILES | COCCNSc1ccc(NC(=O)c2cc(N(CC3CC3)C3CCCCC3)ncn2)c(C)c1 |
| InChI | InChI=1S/C25H35N5O2S/c1-18-14-21(33-28-12-13-32-2)10-11-22(18)29-25(31)23-15-24(27-17-26-23)30(16-19-8-9-19)20-6-4-3-5-7-20/h10-11,14-15,17,19-20,28H,3-9,12-13,16H2,1-2H3,(H,29,31) |
| InChIKey | PIYMZABZIWAQTO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.66 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|