About 1-butylpiperazine;propan-2-one;propylcyclohexane
1-butylpiperazine;propan-2-one;propylcyclohexane (PubChem CID 143759167) has the molecular formula C20H42N2O
and a molecular weight of 326.57 g/mol. Its IUPAC name is 1-butylpiperazine;propan-2-one;propylcyclohexane.
Molecular Properties
| Compound Name | 1-butylpiperazine;propan-2-one;propylcyclohexane |
| PubChem CID | 143759167 |
| Molecular Formula | C20H42N2O |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.33 |
| IUPAC Name | 1-butylpiperazine;propan-2-one;propylcyclohexane |
| SMILES | CC(C)=O.CCCC1CCCCC1.CCCCN1CCNCC1 |
| InChI | InChI=1S/C9H18.C8H18N2.C3H6O/c1-2-6-9-7-4-3-5-8-9;1-2-3-6-10-7-4-9-5-8-10;1-3(2)4/h9H,2-8H2,1H3;9H,2-8H2,1H3;1-2H3 |
| InChIKey | DVUHQQVVSBIBOB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butylpiperazine;propan-2-one;propylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylpiperazine;propan-2-one;propylcyclohexane?
The IUPAC name of 1-butylpiperazine;propan-2-one;propylcyclohexane (CID 143759167) is 1-butylpiperazine;propan-2-one;propylcyclohexane.
What is the SMILES notation for 1-butylpiperazine;propan-2-one;propylcyclohexane?
The canonical SMILES for 1-butylpiperazine;propan-2-one;propylcyclohexane is CC(C)=O.CCCC1CCCCC1.CCCCN1CCNCC1.
What is the InChIKey of 1-butylpiperazine;propan-2-one;propylcyclohexane?
The InChIKey is DVUHQQVVSBIBOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C8H18N2.C3H6O/c1-2-6-9-7-4-3-5-8-9;1-2-3-6-10-7-4-9-5-8-10;1-3(2)4/h9H,2-8H2,1H3;9H,2-8H2,1H3;1-2H3.
What are the key properties of 1-butylpiperazine;propan-2-one;propylcyclohexane?
1-butylpiperazine;propan-2-one;propylcyclohexane has a molecular weight of 326.57 g/mol, XLogP of 4.65, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylpiperazine;propan-2-one;propylcyclohexane is sourced from PubChem (CID 143759167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).