C19H23OS+ — CID 143759528
cyclohexa-1,3-dien-1-yl-cyclohexa-1,5-dien-1-yl-(4-methoxycyclohexa-1,3-dien-1-yl)sulfanium (PubChem CID 143759528) has the molecular formula C19H23OS+ and a molecular weight of 299.46 g/mol. Its IUPAC name is cyclohexa-1,3-dien-1-yl-cyclohexa-1,5-dien-1-yl-(4-methoxycyclohexa-1,3-dien-1-yl)sulfanium.
| Compound Name | cyclohexa-1,3-dien-1-yl-cyclohexa-1,5-dien-1-yl-(4-methoxycyclohexa-1,3-dien-1-yl)sulfanium |
|---|---|
| PubChem CID | 143759528 |
| Molecular Formula | C19H23OS+ |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | cyclohexa-1,3-dien-1-yl-cyclohexa-1,5-dien-1-yl-(4-methoxycyclohexa-1,3-dien-1-yl)sulfanium |
| SMILES | COC1=CC=C([S+](C2=CCCC=C2)C2=CC=CCC2)CC1 |
| InChI | InChI=1S/C19H23OS/c1-20-16-12-14-19(15-13-16)21(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2,4,6,8,10-12,14H,3,5,7,9,13,15H2,1H3/q+1 |
| InChIKey | GBVSPYJFAADKFQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|