C12H13F2N — CID 143759772
(4Z)-N-ethenyl-4,5-difluoro-6-methyl-2,3-dimethylidenehepta-4,6-dien-1-imine (PubChem CID 143759772) has the molecular formula C12H13F2N and a molecular weight of 209.24 g/mol. Its IUPAC name is (4Z)-N-ethenyl-4,5-difluoro-6-methyl-2,3-dimethylidenehepta-4,6-dien-1-imine.
| Compound Name | (4Z)-N-ethenyl-4,5-difluoro-6-methyl-2,3-dimethylidenehepta-4,6-dien-1-imine |
|---|---|
| PubChem CID | 143759772 |
| Molecular Formula | C12H13F2N |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | (4Z)-N-ethenyl-4,5-difluoro-6-methyl-2,3-dimethylidenehepta-4,6-dien-1-imine |
| SMILES | C=C/N=C/C(=C)C(=C)/C(F)=C(/F)C(=C)C |
| InChI | InChI=1S/C12H13F2N/c1-6-15-7-9(4)10(5)12(14)11(13)8(2)3/h6-7H,1-2,4-5H2,3H3/b12-11-,15-7+ |
| InChIKey | AUOLELNODMBXAM-IVSGXJALSA-N |
| XLogP | 4.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|