C11H16N2 — CID 143760331
3,7-dimethyl-3,6,8,9-tetrahydropyrido[4,3-b]azepine (PubChem CID 143760331) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 3,7-dimethyl-3,6,8,9-tetrahydropyrido[4,3-b]azepine.
| Compound Name | 3,7-dimethyl-3,6,8,9-tetrahydropyrido[4,3-b]azepine |
|---|---|
| PubChem CID | 143760331 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 3,7-dimethyl-3,6,8,9-tetrahydropyrido[4,3-b]azepine |
| SMILES | CC1C=CC2=C(CCN(C)C2)N=C1 |
| InChI | InChI=1S/C11H16N2/c1-9-3-4-10-8-13(2)6-5-11(10)12-7-9/h3-4,7,9H,5-6,8H2,1-2H3 |
| InChIKey | WEUGXWTVKWMABG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |