C25H34N4O2S — CID 143760416
1-[2-benzyl-5-ethyl-4-(piperazine-1-carbonyl)phenyl]-3-(3-methylsulfanylpropyl)urea (PubChem CID 143760416) has the molecular formula C25H34N4O2S and a molecular weight of 454.64 g/mol. Its IUPAC name is 1-[2-benzyl-5-ethyl-4-(piperazine-1-carbonyl)phenyl]-3-(3-methylsulfanylpropyl)urea.
| Compound Name | 1-[2-benzyl-5-ethyl-4-(piperazine-1-carbonyl)phenyl]-3-(3-methylsulfanylpropyl)urea |
|---|---|
| PubChem CID | 143760416 |
| Molecular Formula | C25H34N4O2S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 1-[2-benzyl-5-ethyl-4-(piperazine-1-carbonyl)phenyl]-3-(3-methylsulfanylpropyl)urea |
| SMILES | CCc1cc(NC(=O)NCCCSC)c(Cc2ccccc2)cc1C(=O)N1CCNCC1 |
| InChI | InChI=1S/C25H34N4O2S/c1-3-20-18-23(28-25(31)27-10-7-15-32-2)21(16-19-8-5-4-6-9-19)17-22(20)24(30)29-13-11-26-12-14-29/h4-6,8-9,17-18,26H,3,7,10-16H2,1-2H3,(H2,27,28,31) |
| InChIKey | XJNTWJPMFUBLIL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|