C20H27N2NaO2 — CID 143760601
sodium;ethane;2-hexan-3-yl-5-(5-methyl-3-pyridinyl)pyridine-3-carboxylate (PubChem CID 143760601) has the molecular formula C20H27N2NaO2 and a molecular weight of 350.44 g/mol. Its IUPAC name is sodium;ethane;2-hexan-3-yl-5-(5-methyl-3-pyridinyl)pyridine-3-carboxylate.
| Compound Name | sodium;ethane;2-hexan-3-yl-5-(5-methyl-3-pyridinyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 143760601 |
| Molecular Formula | C20H27N2NaO2 |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | sodium;ethane;2-hexan-3-yl-5-(5-methyl-3-pyridinyl)pyridine-3-carboxylate |
| SMILES | CC.CCCC(CC)c1ncc(-c2cncc(C)c2)cc1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C18H22N2O2.C2H6.Na/c1-4-6-13(5-2)17-16(18(21)22)8-15(11-20-17)14-7-12(3)9-19-10-14;1-2;/h7-11,13H,4-6H2,1-3H3,(H,21,22);1-2H3;/q;;+1/p-1 |
| InChIKey | ZLZKBFGJBLZYLC-UHFFFAOYSA-M |
| XLogP | 1.14 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |