C13H9Cl2N5OS — CID 143761062
4-chloro-2-[(2-chloro-7-sulfanylpyrrolo[2,3-d]pyrimidin-4-yl)amino]benzamide (PubChem CID 143761062) has the molecular formula C13H9Cl2N5OS and a molecular weight of 354.22 g/mol. Its IUPAC name is 4-chloro-2-[(2-chloro-7-sulfanylpyrrolo[2,3-d]pyrimidin-4-yl)amino]benzamide.
| Compound Name | 4-chloro-2-[(2-chloro-7-sulfanylpyrrolo[2,3-d]pyrimidin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 143761062 |
| Molecular Formula | C13H9Cl2N5OS |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 4-chloro-2-[(2-chloro-7-sulfanylpyrrolo[2,3-d]pyrimidin-4-yl)amino]benzamide |
| SMILES | NC(=O)c1ccc(Cl)cc1Nc1nc(Cl)nc2c1ccn2S |
| InChI | InChI=1S/C13H9Cl2N5OS/c14-6-1-2-7(10(16)21)9(5-6)17-11-8-3-4-20(22)12(8)19-13(15)18-11/h1-5,22H,(H2,16,21)(H,17,18,19) |
| InChIKey | WTWNGWDKXUGXHY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|