About 3-[(3E)-3-ethenylhexa-3,5-dien-2-yl]oxy-N,2-dimethylbut-3-en-2-amine
3-[(3E)-3-ethenylhexa-3,5-dien-2-yl]oxy-N,2-dimethylbut-3-en-2-amine (PubChem CID 143762718) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is 3-[(3E)-3-ethenylhexa-3,5-dien-2-yl]oxy-N,2-dimethylbut-3-en-2-amine.
Molecular Properties
| Compound Name | 3-[(3E)-3-ethenylhexa-3,5-dien-2-yl]oxy-N,2-dimethylbut-3-en-2-amine |
| PubChem CID | 143762718 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 3-[(3E)-3-ethenylhexa-3,5-dien-2-yl]oxy-N,2-dimethylbut-3-en-2-amine |
| SMILES | C=C/C=C(\C=C)C(C)OC(=C)C(C)(C)NC |
| InChI | InChI=1S/C14H23NO/c1-8-10-13(9-2)11(3)16-12(4)14(5,6)15-7/h8-11,15H,1-2,4H2,3,5-7H3/b13-10+ |
| InChIKey | OOHKQTWDGKZLKD-JLHYYAGUSA-N |
| XLogP | 3.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3E)-3-ethenylhexa-3,5-dien-2-yl]oxy-N,2-dimethylbut-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3E)-3-ethenylhexa-3,5-dien-2-yl]oxy-N,2-dimethylbut-3-en-2-amine?
The IUPAC name of 3-[(3E)-3-ethenylhexa-3,5-dien-2-yl]oxy-N,2-dimethylbut-3-en-2-amine (CID 143762718) is 3-[(3E)-3-ethenylhexa-3,5-dien-2-yl]oxy-N,2-dimethylbut-3-en-2-amine.
What is the SMILES notation for 3-[(3E)-3-ethenylhexa-3,5-dien-2-yl]oxy-N,2-dimethylbut-3-en-2-amine?
The canonical SMILES for 3-[(3E)-3-ethenylhexa-3,5-dien-2-yl]oxy-N,2-dimethylbut-3-en-2-amine is C=C/C=C(\C=C)C(C)OC(=C)C(C)(C)NC.
What is the InChIKey of 3-[(3E)-3-ethenylhexa-3,5-dien-2-yl]oxy-N,2-dimethylbut-3-en-2-amine?
The InChIKey is OOHKQTWDGKZLKD-JLHYYAGUSA-N. The full InChI is InChI=1S/C14H23NO/c1-8-10-13(9-2)11(3)16-12(4)14(5,6)15-7/h8-11,15H,1-2,4H2,3,5-7H3/b13-10+.
What are the key properties of 3-[(3E)-3-ethenylhexa-3,5-dien-2-yl]oxy-N,2-dimethylbut-3-en-2-amine?
3-[(3E)-3-ethenylhexa-3,5-dien-2-yl]oxy-N,2-dimethylbut-3-en-2-amine has a molecular weight of 221.34 g/mol, XLogP of 3.20, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3E)-3-ethenylhexa-3,5-dien-2-yl]oxy-N,2-dimethylbut-3-en-2-amine is sourced from PubChem (CID 143762718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).