C30H37ClF4N2O — CID 143763165
(Z)-3-chloro-1-[4-(2-fluorophenyl)piperidin-1-yl]-2-methylbut-2-en-1-one;(1E,3E,4E)-2-ethenyl-3-ethylidene-N,6-dimethyl-5-(trifluoromethyl)hepta-1,4,6-trien-1-amine (PubChem CID 143763165) has the molecular formula C30H37ClF4N2O and a molecular weight of 553.08 g/mol. Its IUPAC name is (Z)-3-chloro-1-[4-(2-fluorophenyl)piperidin-1-yl]-2-methylbut-2-en-1-one;(1E,3E,4E)-2-ethenyl-3-ethylidene-N,6-dimethyl-5-(trifluoromethyl)hepta-1,4,6-trien-1-amine.
| Compound Name | (Z)-3-chloro-1-[4-(2-fluorophenyl)piperidin-1-yl]-2-methylbut-2-en-1-one;(1E,3E,4E)-2-ethenyl-3-ethylidene-N,6-dimethyl-5-(trifluoromethyl)hepta-1,4,6-trien-1-amine |
|---|---|
| PubChem CID | 143763165 |
| Molecular Formula | C30H37ClF4N2O |
| Molecular Weight | 553.08 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | (Z)-3-chloro-1-[4-(2-fluorophenyl)piperidin-1-yl]-2-methylbut-2-en-1-one;(1E,3E,4E)-2-ethenyl-3-ethylidene-N,6-dimethyl-5-(trifluoromethyl)hepta-1,4,6-trien-1-amine |
| SMILES | C/C(Cl)=C(\C)C(=O)N1CCC(c2ccccc2F)CC1.C=CC(=C\NC)/C(/C=C(/C(=C)C)C(F)(F)F)=C/C |
| InChI | InChI=1S/C16H19ClFNO.C14H18F3N/c1-11(12(2)17)16(20)19-9-7-13(8-10-19)14-5-3-4-6-15(14)18;1-6-11(12(7-2)9-18-5)8-13(10(3)4)14(15,16)17/h3-6,13H,7-10H2,1-2H3;6-9,18H,2-3H2,1,4-5H3/b12-11-;11-6-,12-9+,13-8+ |
| InChIKey | BWOCJJHFKRVNEM-BTQPSKCMSA-N |
| XLogP | 8.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.08 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|