C18H20F3NO — CID 143763199
(Z)-3-[[(3E,5E)-5-cyclopenta-1,4-dien-1-yl-3-(trifluoromethyl)hepta-3,5-dien-2-ylidene]amino]pent-3-en-2-one (PubChem CID 143763199) has the molecular formula C18H20F3NO and a molecular weight of 323.36 g/mol. Its IUPAC name is (Z)-3-[[(3E,5E)-5-cyclopenta-1,4-dien-1-yl-3-(trifluoromethyl)hepta-3,5-dien-2-ylidene]amino]pent-3-en-2-one.
| Compound Name | (Z)-3-[[(3E,5E)-5-cyclopenta-1,4-dien-1-yl-3-(trifluoromethyl)hepta-3,5-dien-2-ylidene]amino]pent-3-en-2-one |
|---|---|
| PubChem CID | 143763199 |
| Molecular Formula | C18H20F3NO |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (Z)-3-[[(3E,5E)-5-cyclopenta-1,4-dien-1-yl-3-(trifluoromethyl)hepta-3,5-dien-2-ylidene]amino]pent-3-en-2-one |
| SMILES | C/C=C(\N=C(C)\C(=C/C(=C\C)C1=CCC=C1)C(F)(F)F)C(C)=O |
| InChI | InChI=1S/C18H20F3NO/c1-5-14(15-9-7-8-10-15)11-16(18(19,20)21)12(3)22-17(6-2)13(4)23/h5-7,9-11H,8H2,1-4H3/b14-5+,16-11+,17-6-,22-12+ |
| InChIKey | DVGXSHVECJHEPQ-CAHHCAKBSA-N |
| XLogP | 5.26 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|