C20H15F3N2O2S — CID 143763281
1-[6-(furan-3-yl)-4-(trifluoromethyl)-1H-benzimidazol-2-yl]-4-thiophen-2-ylbutan-1-one (PubChem CID 143763281) has the molecular formula C20H15F3N2O2S and a molecular weight of 404.41 g/mol. Its IUPAC name is 1-[6-(furan-3-yl)-4-(trifluoromethyl)-1H-benzimidazol-2-yl]-4-thiophen-2-ylbutan-1-one.
| Compound Name | 1-[6-(furan-3-yl)-4-(trifluoromethyl)-1H-benzimidazol-2-yl]-4-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 143763281 |
| Molecular Formula | C20H15F3N2O2S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 1-[6-(furan-3-yl)-4-(trifluoromethyl)-1H-benzimidazol-2-yl]-4-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCc1cccs1)c1nc2c(C(F)(F)F)cc(-c3ccoc3)cc2[nH]1 |
| InChI | InChI=1S/C20H15F3N2O2S/c21-20(22,23)15-9-13(12-6-7-27-11-12)10-16-18(15)25-19(24-16)17(26)5-1-3-14-4-2-8-28-14/h2,4,6-11H,1,3,5H2,(H,24,25) |
| InChIKey | ZSBVCZNAXFINOC-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |