C7H13F2NO2 — CID 143764227
3,3-difluoro-5-(hydroxymethyl)pyrrolidin-2-one;ethane (PubChem CID 143764227) has the molecular formula C7H13F2NO2 and a molecular weight of 181.18 g/mol. Its IUPAC name is 3,3-difluoro-5-(hydroxymethyl)pyrrolidin-2-one;ethane.
| Compound Name | 3,3-difluoro-5-(hydroxymethyl)pyrrolidin-2-one;ethane |
|---|---|
| PubChem CID | 143764227 |
| Molecular Formula | C7H13F2NO2 |
| Molecular Weight | 181.18 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 3,3-difluoro-5-(hydroxymethyl)pyrrolidin-2-one;ethane |
| SMILES | CC.O=C1NC(CO)CC1(F)F |
| InChI | InChI=1S/C5H7F2NO2.C2H6/c6-5(7)1-3(2-9)8-4(5)10;1-2/h3,9H,1-2H2,(H,8,10);1-2H3 |
| InChIKey | LVMFFSSPCAYRAR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |