C22H20N4O4 — CID 143765053
2-amino-3-[3-[(4-oxo-5-phenyl-1,3-oxazolidin-2-ylidene)amino]propylamino]naphthalene-1,4-dione (PubChem CID 143765053) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is 2-amino-3-[3-[(4-oxo-5-phenyl-1,3-oxazolidin-2-ylidene)amino]propylamino]naphthalene-1,4-dione.
| Compound Name | 2-amino-3-[3-[(4-oxo-5-phenyl-1,3-oxazolidin-2-ylidene)amino]propylamino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 143765053 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-amino-3-[3-[(4-oxo-5-phenyl-1,3-oxazolidin-2-ylidene)amino]propylamino]naphthalene-1,4-dione |
| SMILES | NC1=C(NCCC/N=C2/NC(=O)C(c3ccccc3)O2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H20N4O4/c23-16-17(19(28)15-10-5-4-9-14(15)18(16)27)24-11-6-12-25-22-26-21(29)20(30-22)13-7-2-1-3-8-13/h1-5,7-10,20,24H,6,11-12,23H2,(H,25,26,29) |
| InChIKey | HNSPRTSLDZVXMP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|