C13H20N2O — CID 143765527
ethane;2-methyl-5-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,3,4-oxadiazole (PubChem CID 143765527) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is ethane;2-methyl-5-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,3,4-oxadiazole.
| Compound Name | ethane;2-methyl-5-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 143765527 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | ethane;2-methyl-5-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,3,4-oxadiazole |
| SMILES | C=C/C(=C\C=C(C)C)c1nnc(C)o1.CC |
| InChI | InChI=1S/C11H14N2O.C2H6/c1-5-10(7-6-8(2)3)11-13-12-9(4)14-11;1-2/h5-7H,1H2,2-4H3;1-2H3/b10-7+; |
| InChIKey | YLBIHHBHNWXQMU-HCUGZAAXSA-N |
| XLogP | 3.94 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|