C27H34FN5O6 — CID 143765886
N-[(3Z)-5-fluoro-3-[[4-hydroxy-5-(2-hydroxy-3-morpholin-4-ylpropyl)-3-methyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridin-2-yl]methylidene]-2-oxo-1H-indol-6-yl]-2-methoxyacetamide (PubChem CID 143765886) has the molecular formula C27H34FN5O6 and a molecular weight of 543.60 g/mol. Its IUPAC name is N-[(3Z)-5-fluoro-3-[[4-hydroxy-5-(2-hydroxy-3-morpholin-4-ylpropyl)-3-methyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridin-2-yl]methylidene]-2-oxo-1H-indol-6-yl]-2-methoxyacetamide.
| Compound Name | N-[(3Z)-5-fluoro-3-[[4-hydroxy-5-(2-hydroxy-3-morpholin-4-ylpropyl)-3-methyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridin-2-yl]methylidene]-2-oxo-1H-indol-6-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 143765886 |
| Molecular Formula | C27H34FN5O6 |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | N-[(3Z)-5-fluoro-3-[[4-hydroxy-5-(2-hydroxy-3-morpholin-4-ylpropyl)-3-methyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridin-2-yl]methylidene]-2-oxo-1H-indol-6-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1cc2c(cc1F)/C(=C/c1[nH]c3c(c1C)C(O)N(CC(O)CN1CCOCC1)CC3)C(=O)N2 |
| InChI | InChI=1S/C27H34FN5O6/c1-15-21(10-18-17-9-19(28)23(30-24(35)14-38-2)11-22(17)31-26(18)36)29-20-3-4-33(27(37)25(15)20)13-16(34)12-32-5-7-39-8-6-32/h9-11,16,27,29,34,37H,3-8,12-14H2,1-2H3,(H,30,35)(H,31,36)/b18-10- |
| InChIKey | BGGUKLNKBMKKCH-ZDLGFXPLSA-N |
| XLogP | 1.08 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|