C21H20N4O3 — CID 143766220
4-[[[3-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]methyl]benzaldehyde;methanol (PubChem CID 143766220) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 4-[[[3-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]methyl]benzaldehyde;methanol.
| Compound Name | 4-[[[3-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]methyl]benzaldehyde;methanol |
|---|---|
| PubChem CID | 143766220 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 4-[[[3-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]methyl]benzaldehyde;methanol |
| SMILES | CO.O=Cc1ccc(CNc2nccn3c(-c4ccc(O)cc4)cnc23)cc1 |
| InChI | InChI=1S/C20H16N4O2.CH4O/c25-13-15-3-1-14(2-4-15)11-22-19-20-23-12-18(24(20)10-9-21-19)16-5-7-17(26)8-6-16;1-2/h1-10,12-13,26H,11H2,(H,21,22);2H,1H3 |
| InChIKey | BOKLBVXKRXDAHU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|