C20H35NO7 — CID 14376633
[(3R,4R,5S,6S)-6-amino-4,5-bis(2,2-dimethylpropanoyloxy)oxan-3-yl] 2,2-dimethylpropanoate (PubChem CID 14376633) has the molecular formula C20H35NO7 and a molecular weight of 401.50 g/mol. Its IUPAC name is [(3R,4R,5S,6S)-6-amino-4,5-bis(2,2-dimethylpropanoyloxy)oxan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3R,4R,5S,6S)-6-amino-4,5-bis(2,2-dimethylpropanoyloxy)oxan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 14376633 |
| Molecular Formula | C20H35NO7 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | [(3R,4R,5S,6S)-6-amino-4,5-bis(2,2-dimethylpropanoyloxy)oxan-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@H]1[C@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)CO[C@@H]1N |
| InChI | InChI=1S/C20H35NO7/c1-18(2,3)15(22)26-11-10-25-14(21)13(28-17(24)20(7,8)9)12(11)27-16(23)19(4,5)6/h11-14H,10,21H2,1-9H3/t11-,12-,13+,14+/m1/s1 |
| InChIKey | LEPTZLBNHYYGOX-MQYQWHSLSA-N |
| XLogP | 2.18 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|