C21H23F2N5O2 — CID 143766703
5-[[2-[4-(4-ethyl-3,5-difluorophenyl)piperazin-1-yl]-2-oxoethyl]amino]-1,3-dihydrobenzimidazol-2-one (PubChem CID 143766703) has the molecular formula C21H23F2N5O2 and a molecular weight of 415.44 g/mol. Its IUPAC name is 5-[[2-[4-(4-ethyl-3,5-difluorophenyl)piperazin-1-yl]-2-oxoethyl]amino]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[[2-[4-(4-ethyl-3,5-difluorophenyl)piperazin-1-yl]-2-oxoethyl]amino]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 143766703 |
| Molecular Formula | C21H23F2N5O2 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 5-[[2-[4-(4-ethyl-3,5-difluorophenyl)piperazin-1-yl]-2-oxoethyl]amino]-1,3-dihydrobenzimidazol-2-one |
| SMILES | CCc1c(F)cc(N2CCN(C(=O)CNc3ccc4[nH]c(=O)[nH]c4c3)CC2)cc1F |
| InChI | InChI=1S/C21H23F2N5O2/c1-2-15-16(22)10-14(11-17(15)23)27-5-7-28(8-6-27)20(29)12-24-13-3-4-18-19(9-13)26-21(30)25-18/h3-4,9-11,24H,2,5-8,12H2,1H3,(H2,25,26,30) |
| InChIKey | FRAAOUZNMFIGLV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_A(5)', 'substructure': 'N/A'} |
|---|