C22H19ClN4O4 — CID 143766772
2-[(3R)-4-(4-chloro-3-methylphenyl)-3-ethynylpiperazin-1-yl]-2-oxo-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide (PubChem CID 143766772) has the molecular formula C22H19ClN4O4 and a molecular weight of 438.87 g/mol. Its IUPAC name is 2-[(3R)-4-(4-chloro-3-methylphenyl)-3-ethynylpiperazin-1-yl]-2-oxo-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide.
| Compound Name | 2-[(3R)-4-(4-chloro-3-methylphenyl)-3-ethynylpiperazin-1-yl]-2-oxo-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide |
|---|---|
| PubChem CID | 143766772 |
| Molecular Formula | C22H19ClN4O4 |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 2-[(3R)-4-(4-chloro-3-methylphenyl)-3-ethynylpiperazin-1-yl]-2-oxo-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide |
| SMILES | C#C[C@@H]1CN(C(=O)C(=O)Nc2ccc3[nH]c(=O)oc3c2)CCN1c1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C22H19ClN4O4/c1-3-15-12-26(8-9-27(15)16-5-6-17(23)13(2)10-16)21(29)20(28)24-14-4-7-18-19(11-14)31-22(30)25-18/h1,4-7,10-11,15H,8-9,12H2,2H3,(H,24,28)(H,25,30)/t15-/m1/s1 |
| InChIKey | AHZPZJWWHYIKJU-OAHLLOKOSA-N |
| XLogP | 2.37 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|