C13H17F3N2O2 — CID 143766856
4-[(4R)-4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]piperazine-1-carbaldehyde (PubChem CID 143766856) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.29 g/mol. Its IUPAC name is 4-[(4R)-4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[(4R)-4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 143766856 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4-[(4R)-4-(2,2,2-trifluoroethoxy)cyclohexa-1,5-dien-1-yl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(C2=CC[C@@H](OCC(F)(F)F)C=C2)CC1 |
| InChI | InChI=1S/C13H17F3N2O2/c14-13(15,16)9-20-12-3-1-11(2-4-12)18-7-5-17(10-19)6-8-18/h1-3,10,12H,4-9H2/t12-/m0/s1 |
| InChIKey | LFUKQHPHYNPSGD-LBPRGKRZSA-N |
| XLogP | 1.55 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|