C31H51N3O — CID 143766999
(2E,4E,6Z)-6-(ethylideneamino)-5-hex-2-enyl-2,10-dimethyl-8-methylidene-1-(4-methylpiperazin-1-yl)-4-(2-methylpropyl)undeca-2,4,6-trien-1-one (PubChem CID 143766999) has the molecular formula C31H51N3O and a molecular weight of 481.77 g/mol. Its IUPAC name is (2E,4E,6Z)-6-(ethylideneamino)-5-hex-2-enyl-2,10-dimethyl-8-methylidene-1-(4-methylpiperazin-1-yl)-4-(2-methylpropyl)undeca-2,4,6-trien-1-one.
| Compound Name | (2E,4E,6Z)-6-(ethylideneamino)-5-hex-2-enyl-2,10-dimethyl-8-methylidene-1-(4-methylpiperazin-1-yl)-4-(2-methylpropyl)undeca-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 143766999 |
| Molecular Formula | C31H51N3O |
| Molecular Weight | 481.77 g/mol |
| Exact Mass | 481.40 |
| IUPAC Name | (2E,4E,6Z)-6-(ethylideneamino)-5-hex-2-enyl-2,10-dimethyl-8-methylidene-1-(4-methylpiperazin-1-yl)-4-(2-methylpropyl)undeca-2,4,6-trien-1-one |
| SMILES | C=C(/C=C(\N=C\C)C(/CC=CCCC)=C(/C=C(\C)C(=O)N1CCN(C)CC1)CC(C)C)CC(C)C |
| InChI | InChI=1S/C31H51N3O/c1-10-12-13-14-15-29(30(32-11-2)22-26(7)20-24(3)4)28(21-25(5)6)23-27(8)31(35)34-18-16-33(9)17-19-34/h11,13-14,22-25H,7,10,12,15-21H2,1-6,8-9H3/b14-13?,27-23+,29-28+,30-22-,32-11+ |
| InChIKey | NKFCZSHSPQLJSQ-JLKNMDKHSA-N |
| XLogP | 7.37 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.77 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|