C23H26F2IN3O3 — CID 143767052
tert-butyl N-[(2R,5S)-2-(2,5-difluorophenyl)-5-iodo-6-oxo-1-(2-pyridin-2-ylethyl)piperidin-3-yl]carbamate (PubChem CID 143767052) has the molecular formula C23H26F2IN3O3 and a molecular weight of 557.38 g/mol. Its IUPAC name is tert-butyl N-[(2R,5S)-2-(2,5-difluorophenyl)-5-iodo-6-oxo-1-(2-pyridin-2-ylethyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,5S)-2-(2,5-difluorophenyl)-5-iodo-6-oxo-1-(2-pyridin-2-ylethyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 143767052 |
| Molecular Formula | C23H26F2IN3O3 |
| Molecular Weight | 557.38 g/mol |
| Exact Mass | 557.10 |
| IUPAC Name | tert-butyl N-[(2R,5S)-2-(2,5-difluorophenyl)-5-iodo-6-oxo-1-(2-pyridin-2-ylethyl)piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1C[C@H](I)C(=O)N(CCc2ccccn2)[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C23H26F2IN3O3/c1-23(2,3)32-22(31)28-19-13-18(26)21(30)29(11-9-15-6-4-5-10-27-15)20(19)16-12-14(24)7-8-17(16)25/h4-8,10,12,18-20H,9,11,13H2,1-3H3,(H,28,31)/t18-,19?,20+/m0/s1 |
| InChIKey | IURSLJSXKFQPNI-SJBAFXMYSA-N |
| XLogP | 4.57 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|