C17H35N5O2 — CID 143767682
1,1-diethyl-3-methylurea;ethane;1-methyl-3-pyridin-3-ylurea (PubChem CID 143767682) has the molecular formula C17H35N5O2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 1,1-diethyl-3-methylurea;ethane;1-methyl-3-pyridin-3-ylurea.
| Compound Name | 1,1-diethyl-3-methylurea;ethane;1-methyl-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 143767682 |
| Molecular Formula | C17H35N5O2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | 1,1-diethyl-3-methylurea;ethane;1-methyl-3-pyridin-3-ylurea |
| SMILES | CC.CC.CCN(CC)C(=O)NC.CNC(=O)Nc1cccnc1 |
| InChI | InChI=1S/C7H9N3O.C6H14N2O.2C2H6/c1-8-7(11)10-6-3-2-4-9-5-6;1-4-8(5-2)6(9)7-3;2*1-2/h2-5H,1H3,(H2,8,10,11);4-5H2,1-3H3,(H,7,9);2*1-2H3 |
| InChIKey | CCWISQPJOGNPMH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |