C26H26N2O4 — CID 143767907
6,7-dimethyl-3,10,17,24-tetraoxa-29,30-diazapentacyclo[24.2.1.112,15.04,9.018,23]triaconta-1(28),4(9),5,7,12,14,18,20,22,26-decaene (PubChem CID 143767907) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 6,7-dimethyl-3,10,17,24-tetraoxa-29,30-diazapentacyclo[24.2.1.112,15.04,9.018,23]triaconta-1(28),4(9),5,7,12,14,18,20,22,26-decaene.
| Compound Name | 6,7-dimethyl-3,10,17,24-tetraoxa-29,30-diazapentacyclo[24.2.1.112,15.04,9.018,23]triaconta-1(28),4(9),5,7,12,14,18,20,22,26-decaene |
|---|---|
| PubChem CID | 143767907 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 6,7-dimethyl-3,10,17,24-tetraoxa-29,30-diazapentacyclo[24.2.1.112,15.04,9.018,23]triaconta-1(28),4(9),5,7,12,14,18,20,22,26-decaene |
| SMILES | Cc1cc2c(cc1C)OCc1ccc([nH]1)COc1ccccc1OCc1ccc([nH]1)CO2 |
| InChI | InChI=1S/C26H26N2O4/c1-17-11-25-26(12-18(17)2)32-16-22-10-8-20(28-22)14-30-24-6-4-3-5-23(24)29-13-19-7-9-21(27-19)15-31-25/h3-12,27-28H,13-16H2,1-2H3 |
| InChIKey | HGIVJOKUIAQTRQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |