About (3Z)-1-amino-3-ethenylhexa-3,5-dien-1-ol;ethane
(3Z)-1-amino-3-ethenylhexa-3,5-dien-1-ol;ethane (PubChem CID 143768232) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is (3Z)-1-amino-3-ethenylhexa-3,5-dien-1-ol;ethane.
Molecular Properties
| Compound Name | (3Z)-1-amino-3-ethenylhexa-3,5-dien-1-ol;ethane |
| PubChem CID | 143768232 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (3Z)-1-amino-3-ethenylhexa-3,5-dien-1-ol;ethane |
| SMILES | C=C/C=C(\C=C)CC(N)O.CC |
| InChI | InChI=1S/C8H13NO.C2H6/c1-3-5-7(4-2)6-8(9)10;1-2/h3-5,8,10H,1-2,6,9H2;1-2H3/b7-5+; |
| InChIKey | VTXDKKOKILVRSY-GZOLSCHFSA-N |
| XLogP | 1.98 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-1-amino-3-ethenylhexa-3,5-dien-1-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-1-amino-3-ethenylhexa-3,5-dien-1-ol;ethane?
The IUPAC name of (3Z)-1-amino-3-ethenylhexa-3,5-dien-1-ol;ethane (CID 143768232) is (3Z)-1-amino-3-ethenylhexa-3,5-dien-1-ol;ethane.
What is the SMILES notation for (3Z)-1-amino-3-ethenylhexa-3,5-dien-1-ol;ethane?
The canonical SMILES for (3Z)-1-amino-3-ethenylhexa-3,5-dien-1-ol;ethane is C=C/C=C(\C=C)CC(N)O.CC.
What is the InChIKey of (3Z)-1-amino-3-ethenylhexa-3,5-dien-1-ol;ethane?
The InChIKey is VTXDKKOKILVRSY-GZOLSCHFSA-N. The full InChI is InChI=1S/C8H13NO.C2H6/c1-3-5-7(4-2)6-8(9)10;1-2/h3-5,8,10H,1-2,6,9H2;1-2H3/b7-5+;.
What are the key properties of (3Z)-1-amino-3-ethenylhexa-3,5-dien-1-ol;ethane?
(3Z)-1-amino-3-ethenylhexa-3,5-dien-1-ol;ethane has a molecular weight of 169.27 g/mol, XLogP of 1.98, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-1-amino-3-ethenylhexa-3,5-dien-1-ol;ethane is sourced from PubChem (CID 143768232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).