About CID 143768247
CID 143768247 (PubChem CID 143768247) has the molecular formula C13H22NO2S3
and a molecular weight of 320.53 g/mol.
Molecular Properties
| Compound Name | CID 143768247 |
| PubChem CID | 143768247 |
| Molecular Formula | C13H22NO2S3 |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | — |
| SMILES | CC.[CH2]C([CH2])SNC([CH2])c1cc(C)sc1S(C)(=O)=O |
| InChI | InChI=1S/C11H16NO2S3.C2H6/c1-7(2)16-12-9(4)10-6-8(3)15-11(10)17(5,13)14;1-2/h6-7,9,12H,1-2,4H2,3,5H3;1-2H3 |
| InChIKey | BJYTVPFJYQULBK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 143768247 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143768247?
The IUPAC name of CID 143768247 (CID 143768247) is not available.
What is the SMILES notation for CID 143768247?
The canonical SMILES for CID 143768247 is CC.[CH2]C([CH2])SNC([CH2])c1cc(C)sc1S(C)(=O)=O.
What is the InChIKey of CID 143768247?
The InChIKey is BJYTVPFJYQULBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16NO2S3.C2H6/c1-7(2)16-12-9(4)10-6-8(3)15-11(10)17(5,13)14;1-2/h6-7,9,12H,1-2,4H2,3,5H3;1-2H3.
What are the key properties of CID 143768247?
CID 143768247 has a molecular weight of 320.53 g/mol, XLogP of 3.64, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143768247 is sourced from PubChem (CID 143768247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).