C11H13FN2O2 — CID 143768512
1-N'-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]cyclopropane-1,1-dicarboxamide (PubChem CID 143768512) has the molecular formula C11H13FN2O2 and a molecular weight of 224.23 g/mol. Its IUPAC name is 1-N'-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 143768512 |
| Molecular Formula | C11H13FN2O2 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-N'-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]cyclopropane-1,1-dicarboxamide |
| SMILES | C=C/C=C(/NC(=O)C1(C(N)=O)CC1)C(=C)F |
| InChI | InChI=1S/C11H13FN2O2/c1-3-4-8(7(2)12)14-10(16)11(5-6-11)9(13)15/h3-4H,1-2,5-6H2,(H2,13,15)(H,14,16)/b8-4+ |
| InChIKey | HCHTYZPVAAYYFH-XBXARRHUSA-N |
| XLogP | 0.92 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|