About ethane;7-ethylthieno[3,2-b]pyridine
ethane;7-ethylthieno[3,2-b]pyridine (PubChem CID 143768576) has the molecular formula C11H15NS
and a molecular weight of 193.31 g/mol. Its IUPAC name is ethane;7-ethylthieno[3,2-b]pyridine.
Molecular Properties
| Compound Name | ethane;7-ethylthieno[3,2-b]pyridine |
| PubChem CID | 143768576 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | ethane;7-ethylthieno[3,2-b]pyridine |
| SMILES | CC.CCc1ccnc2ccsc12 |
| InChI | InChI=1S/C9H9NS.C2H6/c1-2-7-3-5-10-8-4-6-11-9(7)8;1-2/h3-6H,2H2,1H3;1-2H3 |
| InChIKey | OXYPJFALVHRBTG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;7-ethylthieno[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-ethylthieno[3,2-b]pyridine?
The IUPAC name of ethane;7-ethylthieno[3,2-b]pyridine (CID 143768576) is ethane;7-ethylthieno[3,2-b]pyridine.
What is the SMILES notation for ethane;7-ethylthieno[3,2-b]pyridine?
The canonical SMILES for ethane;7-ethylthieno[3,2-b]pyridine is CC.CCc1ccnc2ccsc12.
What is the InChIKey of ethane;7-ethylthieno[3,2-b]pyridine?
The InChIKey is OXYPJFALVHRBTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NS.C2H6/c1-2-7-3-5-10-8-4-6-11-9(7)8;1-2/h3-6H,2H2,1H3;1-2H3.
What are the key properties of ethane;7-ethylthieno[3,2-b]pyridine?
ethane;7-ethylthieno[3,2-b]pyridine has a molecular weight of 193.31 g/mol, XLogP of 3.88, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-ethylthieno[3,2-b]pyridine is sourced from PubChem (CID 143768576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).