C12H15FN2O2 — CID 143768581
1-N'-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-1-N'-methylcyclopropane-1,1-dicarboxamide (PubChem CID 143768581) has the molecular formula C12H15FN2O2 and a molecular weight of 238.26 g/mol. Its IUPAC name is 1-N'-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-1-N'-methylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-1-N'-methylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 143768581 |
| Molecular Formula | C12H15FN2O2 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-N'-[(3E)-2-fluorohexa-1,3,5-trien-3-yl]-1-N'-methylcyclopropane-1,1-dicarboxamide |
| SMILES | C=C/C=C(\C(=C)F)N(C)C(=O)C1(C(N)=O)CC1 |
| InChI | InChI=1S/C12H15FN2O2/c1-4-5-9(8(2)13)15(3)11(17)12(6-7-12)10(14)16/h4-5H,1-2,6-7H2,3H3,(H2,14,16)/b9-5+ |
| InChIKey | VTLSQNVULZYZEH-WEVVVXLNSA-N |
| XLogP | 1.26 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|