About N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopropanamide;methanamine
N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopropanamide;methanamine (PubChem CID 143768894) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopropanamide;methanamine.
Molecular Properties
| Compound Name | N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopropanamide;methanamine |
| PubChem CID | 143768894 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopropanamide;methanamine |
| SMILES | C=C/C=C(\C=C)N(C)C(=O)CC=O.CN |
| InChI | InChI=1S/C10H13NO2.CH5N/c1-4-6-9(5-2)11(3)10(13)7-8-12;1-2/h4-6,8H,1-2,7H2,3H3;2H2,1H3/b9-6+; |
| InChIKey | APSDTVLVIKZWLD-MLBSPLJJSA-N |
| XLogP | 0.86 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopropanamide;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopropanamide;methanamine?
The IUPAC name of N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopropanamide;methanamine (CID 143768894) is N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopropanamide;methanamine.
What is the SMILES notation for N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopropanamide;methanamine?
The canonical SMILES for N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopropanamide;methanamine is C=C/C=C(\C=C)N(C)C(=O)CC=O.CN.
What is the InChIKey of N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopropanamide;methanamine?
The InChIKey is APSDTVLVIKZWLD-MLBSPLJJSA-N. The full InChI is InChI=1S/C10H13NO2.CH5N/c1-4-6-9(5-2)11(3)10(13)7-8-12;1-2/h4-6,8H,1-2,7H2,3H3;2H2,1H3/b9-6+;.
What are the key properties of N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopropanamide;methanamine?
N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopropanamide;methanamine has a molecular weight of 210.28 g/mol, XLogP of 0.86, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopropanamide;methanamine is sourced from PubChem (CID 143768894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).