About 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)dithiol-3-imine
5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)dithiol-3-imine (PubChem CID 143768925) has the molecular formula C19H19NO4S2
and a molecular weight of 389.50 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)dithiol-3-imine.
Molecular Properties
| Compound Name | 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)dithiol-3-imine |
| PubChem CID | 143768925 |
| Molecular Formula | C19H19NO4S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)dithiol-3-imine |
| SMILES | [H]/N=c1\ssc(-c2ccc(OC)cc2)c1-c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C19H19NO4S2/c1-21-13-7-5-11(6-8-13)18-16(19(20)26-25-18)12-9-14(22-2)17(24-4)15(10-12)23-3/h5-10,20H,1-4H3/b20-19- |
| InChIKey | YKSDIJJQVWGZSX-VXPUYCOJSA-N |
| XLogP | 4.66 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)dithiol-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)dithiol-3-imine?
The IUPAC name of 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)dithiol-3-imine (CID 143768925) is 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)dithiol-3-imine.
What is the SMILES notation for 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)dithiol-3-imine?
The canonical SMILES for 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)dithiol-3-imine is [H]/N=c1\ssc(-c2ccc(OC)cc2)c1-c1cc(OC)c(OC)c(OC)c1.
What is the InChIKey of 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)dithiol-3-imine?
The InChIKey is YKSDIJJQVWGZSX-VXPUYCOJSA-N. The full InChI is InChI=1S/C19H19NO4S2/c1-21-13-7-5-11(6-8-13)18-16(19(20)26-25-18)12-9-14(22-2)17(24-4)15(10-12)23-3/h5-10,20H,1-4H3/b20-19-.
What are the key properties of 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)dithiol-3-imine?
5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)dithiol-3-imine has a molecular weight of 389.50 g/mol, XLogP of 4.66, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)dithiol-3-imine is sourced from PubChem (CID 143768925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).