C21H31NO4 — CID 143768960
tert-butyl 6a,8,9,10,10a,11-hexahydro-6H-[1,3]benzodioxolo[7,6-g]quinoline-7-carboxylate;ethane (PubChem CID 143768960) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is tert-butyl 6a,8,9,10,10a,11-hexahydro-6H-[1,3]benzodioxolo[7,6-g]quinoline-7-carboxylate;ethane.
| Compound Name | tert-butyl 6a,8,9,10,10a,11-hexahydro-6H-[1,3]benzodioxolo[7,6-g]quinoline-7-carboxylate;ethane |
|---|---|
| PubChem CID | 143768960 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | tert-butyl 6a,8,9,10,10a,11-hexahydro-6H-[1,3]benzodioxolo[7,6-g]quinoline-7-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCCC2Cc3c(ccc4c3OCO4)CC21 |
| InChI | InChI=1S/C19H25NO4.C2H6/c1-19(2,3)24-18(21)20-8-4-5-13-9-14-12(10-15(13)20)6-7-16-17(14)23-11-22-16;1-2/h6-7,13,15H,4-5,8-11H2,1-3H3;1-2H3 |
| InChIKey | FJNSMBMJRMMTJO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |