C16H21NO2 — CID 143769068
1'-methyl-7'-prop-2-enylspiro[1,3-dioxolane-2,6'-7,8-dihydro-5H-naphthalene]-2'-amine (PubChem CID 143769068) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 1'-methyl-7'-prop-2-enylspiro[1,3-dioxolane-2,6'-7,8-dihydro-5H-naphthalene]-2'-amine.
| Compound Name | 1'-methyl-7'-prop-2-enylspiro[1,3-dioxolane-2,6'-7,8-dihydro-5H-naphthalene]-2'-amine |
|---|---|
| PubChem CID | 143769068 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 1'-methyl-7'-prop-2-enylspiro[1,3-dioxolane-2,6'-7,8-dihydro-5H-naphthalene]-2'-amine |
| SMILES | C=CCC1Cc2c(ccc(N)c2C)CC12OCCO2 |
| InChI | InChI=1S/C16H21NO2/c1-3-4-13-9-14-11(2)15(17)6-5-12(14)10-16(13)18-7-8-19-16/h3,5-6,13H,1,4,7-10,17H2,2H3 |
| InChIKey | NTHKJMCTIHPLNM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|