C10H13NO3 — CID 143769091
(3Z,5E)-5-ethenyl-3-nitroocta-3,5,7-trien-2-ol (PubChem CID 143769091) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is (3Z,5E)-5-ethenyl-3-nitroocta-3,5,7-trien-2-ol.
| Compound Name | (3Z,5E)-5-ethenyl-3-nitroocta-3,5,7-trien-2-ol |
|---|---|
| PubChem CID | 143769091 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (3Z,5E)-5-ethenyl-3-nitroocta-3,5,7-trien-2-ol |
| SMILES | C=C/C=C(C=C)/C=C(/C(C)O)[N+](=O)[O-] |
| InChI | InChI=1S/C10H13NO3/c1-4-6-9(5-2)7-10(8(3)12)11(13)14/h4-8,12H,1-2H2,3H3/b9-6+,10-7- |
| InChIKey | QNNZNNKABUVJRH-FPXDHTHPSA-N |
| XLogP | 1.83 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|