C19H36F3N3O3S — CID 143769110
methanol;N-(2,2,6,6-tetramethyl-1-sulfanylpiperidin-4-yl)-7-[(2,2,2-trifluoroacetyl)amino]heptanamide (PubChem CID 143769110) has the molecular formula C19H36F3N3O3S and a molecular weight of 443.58 g/mol. Its IUPAC name is methanol;N-(2,2,6,6-tetramethyl-1-sulfanylpiperidin-4-yl)-7-[(2,2,2-trifluoroacetyl)amino]heptanamide.
| Compound Name | methanol;N-(2,2,6,6-tetramethyl-1-sulfanylpiperidin-4-yl)-7-[(2,2,2-trifluoroacetyl)amino]heptanamide |
|---|---|
| PubChem CID | 143769110 |
| Molecular Formula | C19H36F3N3O3S |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | methanol;N-(2,2,6,6-tetramethyl-1-sulfanylpiperidin-4-yl)-7-[(2,2,2-trifluoroacetyl)amino]heptanamide |
| SMILES | CC1(C)CC(NC(=O)CCCCCCNC(=O)C(F)(F)F)CC(C)(C)N1S.CO |
| InChI | InChI=1S/C18H32F3N3O2S.CH4O/c1-16(2)11-13(12-17(3,4)24(16)27)23-14(25)9-7-5-6-8-10-22-15(26)18(19,20)21;1-2/h13,27H,5-12H2,1-4H3,(H,22,26)(H,23,25);2H,1H3 |
| InChIKey | BZURBIIHPUOAIV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|